CAS 1255735-09-1 appears in our catalog under these names: 3-(Difluoromethyl)-5-fluoro-1-methyl-1h-pyrazole-4-carboxylic acid, 95%, 3–(Difluoromethyl)–5–fluoro–1–methyl–1H–pyrazole–4–carboxylic acid, 3-(Difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxylic acid 98+%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 50mg.
3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxylic acid (CAS 1255735-09-1) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxylic acid. InChIKey: AXJCNOQHTJLWDH-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxylic acid |
| InChIKey | AXJCNOQHTJLWDH-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)F)C(=O)O)F |
Computed by PubChem (NCBI)