Products 1823912-21-5
CAS 1823912-21-5 appears in our catalog under these names: 1-Methyl-5-(trifluoromethyl)-1h-imidazole-4-carboxylic acid, 95%, 1-Methyl-5-(trifluoromethyl)-1H-imidazole-4-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-methyl-5-(trifluoromethyl)imidazole-4-carboxylic acid (CAS 1823912-21-5) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)imidazole-4-carboxylic acid. InChIKey: ZVMYPWGZBCKYFZ-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)imidazole-4-carboxylic acid |
| InChIKey | ZVMYPWGZBCKYFZ-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)