CAS 119083-00-0 appears in our catalog under these names: 1-Methyl-5-(trifluoromethyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97%, 1–Methyl–5–(trifluoromethyl)pyrazole–4–carboxylic Acid, 1-Methyl-5-(trifluoromethyl)pyrazole-4-carboxylic Acid, >98.0%(GC)(T), 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 200mg, 100mg.
1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 119083-00-0) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: VAKOSNKAXYJZRG-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | VAKOSNKAXYJZRG-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)