CAS 1006340-71-1 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)-1h-pyrazole-5-carboxylic acid, 95%, 1–(2,2,2–Trifluoroethyl)–1H–pyrazole–5–carboxylic acid, 1-(2,2,2-Trifluoroethyl)-1H-pyrazole-5-carboxylic acid, 1-(2,2,2-Trifluoroethyl)-1H-pyrazole-5-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid (CAS 1006340-71-1) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid. InChIKey: AYCDWZAEGMKZNB-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid |
| InChIKey | AYCDWZAEGMKZNB-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)