cas: 288251-60-5 — see every product listed under this CAS number, including other names
1-(2,2,2-Trifluoroethyl)-1H-pyrazole-4-carboxylic acid, 97% (CAS 288251-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075686-100MG |
| cas | 288251-60-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 581.06 Pln | |
| Fluorochem | 1g | 1195.43 Pln | |
| Fluorochem | 5g | 3496.70 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid (CAS 288251-60-5) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid. InChIKey: VPAMEBUGVMETCV-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid |
| InChIKey | VPAMEBUGVMETCV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)