cas: 1006340-71-1 — see every product listed under this CAS number, including other names
1-(2,2,2-Trifluoroethyl)-1H-pyrazole-5-carboxylic acid, 97%, 97% (CAS 1006340-71-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A3YF-100mg |
| cas | 1006340-71-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1893.20 Pln | |
| Chemat | 250mg | 2675.60 Pln | |
| Chemat | 1g | 5277.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid (CAS 1006340-71-1) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid. InChIKey: AYCDWZAEGMKZNB-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid |
| InChIKey | AYCDWZAEGMKZNB-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)