CAS 1340213-90-2 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)pyrimidine-2,4(1H,3H)-dione, 98%, 98%, 1-(2,2,2-Trifluoroethyl)pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (CAS 1340213-90-2) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione. InChIKey: IIQJAWAGVULOHQ-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| InChIKey | IIQJAWAGVULOHQ-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)NC1=O)CC(F)(F)F |
Computed by PubChem (NCBI)