cas: 41542-06-7 — see every product listed under this CAS number, including other names
1-(2,3-Dichlorophenyl)-2-thiourea (CAS 41542-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018542-250MG |
| cas | 41542-06-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 289.50 Pln |
| delivery time | 2-3 weeks |
|---|
(2,3-dichlorophenyl)thiourea (CAS 41542-06-7) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: (2,3-dichlorophenyl)thiourea. InChIKey: AHQMVDBEJWQFIR-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | (2,3-dichlorophenyl)thiourea |
| InChIKey | AHQMVDBEJWQFIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)NC(=S)N |
Computed by PubChem (NCBI)