CAS 1429639-81-5 is the registry number for 2,4-DICHLORO-7-METHYL-5,7-DIHYDROTHIENO(3,4-D)PYRIMIDINE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dichloro-7-methyl-5,7-dihydrothieno[3,4-d]pyrimidine (CAS 1429639-81-5) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: 2,4-dichloro-7-methyl-5,7-dihydrothieno[3,4-d]pyrimidine. InChIKey: CELWEVMHFJQSAE-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | 2,4-dichloro-7-methyl-5,7-dihydrothieno[3,4-d]pyrimidine |
| InChIKey | CELWEVMHFJQSAE-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CS1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)