CAS 63330-57-4 appears in our catalog under these names: 4-chlorobenzo[d]thiazol-2-aminehydrochloride, 2–Benzothiazolamine,4–chloro–hydrochloride (1:1). Offered by: Chemat, GLPBio. Available pack sizes: 25g, 100g.
4-chloro-1,3-benzothiazol-2-amine;hydrochloride (CAS 63330-57-4) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: 4-chloro-1,3-benzothiazol-2-amine;hydrochloride. InChIKey: LLHPVALKHUEAJT-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | 4-chloro-1,3-benzothiazol-2-amine;hydrochloride |
| InChIKey | LLHPVALKHUEAJT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(S2)N.Cl |
Computed by PubChem (NCBI)