cas: 326473-23-8 — see every product listed under this CAS number, including other names
1-(2,4-Dimethoxyphenyl)-N-methylmethanamine hydrochloride, 97% (CAS 326473-23-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609232-100MG |
| cas | 326473-23-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 10g | 2262.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(2,4-dimethoxyphenyl)-N-methylmethanamine;hydrochloride (CAS 326473-23-8) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-(2,4-dimethoxyphenyl)-N-methylmethanamine;hydrochloride. InChIKey: OOSCXCWPGQJADO-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-(2,4-dimethoxyphenyl)-N-methylmethanamine;hydrochloride |
| InChIKey | OOSCXCWPGQJADO-UHFFFAOYSA-N |
| SMILES | CNCC1=C(C=C(C=C1)OC)OC.Cl |
Computed by PubChem (NCBI)