CAS 390815-41-5 appears in our catalog under these names: (R)-3,4-Dimethoxy-alpha-methylbenzylamine hydrochloride, 95%, (R)–1–(3,4–Dimethoxyphenyl)ethanamine hydrochloride, (R)-1-(3,4-Dimethoxyphenyl)ethanamine HCl, (R)-1-(3,4-Dimethoxyphenyl)ethanamine hydrochloride, 97%, 97%, (R)-1-(3,4-DIMETHOXYPHENYL)ETHANAMINE HCL, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(1R)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (CAS 390815-41-5) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1R)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: PQHFDOBOSKIMTO-OGFXRTJISA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1R)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PQHFDOBOSKIMTO-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)