Products 1172878-66-8
CAS 1172878-66-8 appears in our catalog under these names: 1-Amino-2-(4-methoxy-phenyl)-propan-2-ol hydrochloride, 95%, 1-Amino-2-(4-methoxy-phenyl)-propan-2-ol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
1-amino-2-(4-methoxyphenyl)propan-2-ol;hydrochloride (CAS 1172878-66-8) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-amino-2-(4-methoxyphenyl)propan-2-ol;hydrochloride. InChIKey: OTDXEEIYACGIAN-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-amino-2-(4-methoxyphenyl)propan-2-ol;hydrochloride |
| InChIKey | OTDXEEIYACGIAN-UHFFFAOYSA-N |
| SMILES | CC(CN)(C1=CC=C(C=C1)OC)O.Cl |
Computed by PubChem (NCBI)