CAS 1257106-72-1 appears in our catalog under these names: (R)–1–(3,5–Dimethoxyphenyl)ethanamine hydrochloride, (R)-1-(3,5-Dimethoxyphenyl)ethanamine hydrochloride, 95%, (R)-1-(3,5-Dimethoxyphenyl)ethanamine hydrochloride, 98%, (R)-1-(3,5-Dimethoxyphenyl)ethanamine hydrochloride, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(1R)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride (CAS 1257106-72-1) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1R)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: YUPSTPMVIYAHMF-OGFXRTJISA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1R)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | YUPSTPMVIYAHMF-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)