CAS 58577-95-0 appears in our catalog under these names: (R)-2-Amino-3-(benzyloxy)propan-1-ol hydrochloride, 95%, 95%, (R)-2-Amino-3-benzyloxy-1-propanol hydrochloride, 98%, (R)–2–Amino–3–(benzyloxy)propan–1–ol hydrochloride, (R)-2-Amino-3-(benzyloxy)propan-1-ol hydrochloride, 95%. Offered by: Chemat, Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
(2R)-2-amino-3-phenylmethoxypropan-1-ol;hydrochloride (CAS 58577-95-0) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (2R)-2-amino-3-phenylmethoxypropan-1-ol;hydrochloride. InChIKey: BJWHQBTUHVIRJJ-HNCPQSOCSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (2R)-2-amino-3-phenylmethoxypropan-1-ol;hydrochloride |
| InChIKey | BJWHQBTUHVIRJJ-HNCPQSOCSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)