CAS 91252-27-6 appears in our catalog under these names: 1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride, 95%, 1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride, Benzenemethanamine, 3,4-dimethoxy-α-methyl-, hydrochloride (1:1), 95%, 95%, 1-(3,4-Dimethoxyphenyl)ethanamine hydrochloride, 97%, 1-(3,4-Dimethoxyphenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 2.5g, 10g.
1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (CAS 91252-27-6) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: PQHFDOBOSKIMTO-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PQHFDOBOSKIMTO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)