cas: 6590-91-6 — see every product listed under this CAS number, including other names
1-(2,6-Dichlorophenyl)-2-thiourea, 95% (CAS 6590-91-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018545-5G |
| cas | 6590-91-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 383.22 Pln | |
| Fluorochem | 100g | 1309.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,6-dichlorophenyl)thiourea (CAS 6590-91-6) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: (2,6-dichlorophenyl)thiourea. InChIKey: KUQHRGMPBWZVQR-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | (2,6-dichlorophenyl)thiourea |
| InChIKey | KUQHRGMPBWZVQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC(=S)N)Cl |
Computed by PubChem (NCBI)