cas: 154598-53-5 — see every product listed under this CAS number, including other names
1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone, 97%, 97% (CAS 154598-53-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AONH-100mg |
| cas | 154598-53-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 2656.40 Pln | |
| Chemat | 10g | 5142.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone (CAS 154598-53-5) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: NOKSRMDODJGCPZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | NOKSRMDODJGCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)