cas: 125174-25-6 — see every product listed under this CAS number, including other names
1-(2-Bromoethoxy)-4-(trifluoromethyl)benzene 98% (CAS 125174-25-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A519421-100mg |
| cas | 125174-25-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1460.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A519421 |
1-(2-bromoethoxy)-4-(trifluoromethyl)benzene (CAS 125174-25-6) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-(2-bromoethoxy)-4-(trifluoromethyl)benzene. InChIKey: YKZQRODDFYIDRM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-(2-bromoethoxy)-4-(trifluoromethyl)benzene |
| InChIKey | YKZQRODDFYIDRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)OCCBr |
Computed by PubChem (NCBI)