CAS 916420-86-5 is the registry number for 4-Methoxy-2-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1-(bromomethyl)-4-methoxy-2-(trifluoromethyl)benzene (CAS 916420-86-5) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-(bromomethyl)-4-methoxy-2-(trifluoromethyl)benzene. InChIKey: DXAUNLGVNSSAFO-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-(bromomethyl)-4-methoxy-2-(trifluoromethyl)benzene |
| InChIKey | DXAUNLGVNSSAFO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CBr)C(F)(F)F |
Computed by PubChem (NCBI)