CAS 1646161-42-3 is the registry number for 1-Bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
1-bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene (CAS 1646161-42-3) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene. InChIKey: GJDWKPDOEXVYEP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene |
| InChIKey | GJDWKPDOEXVYEP-UHFFFAOYSA-N |
| SMILES | COCC1=C(C=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)