CAS 2150821-68-2 is the registry number for 1-Bromo-4-(2,2-difluoro-propoxy)-2-fluoro-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-bromo-4-(2,2-difluoropropoxy)-2-fluorobenzene (CAS 2150821-68-2) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-bromo-4-(2,2-difluoropropoxy)-2-fluorobenzene. InChIKey: ZNQQBIFWHOKSSV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-bromo-4-(2,2-difluoropropoxy)-2-fluorobenzene |
| InChIKey | ZNQQBIFWHOKSSV-UHFFFAOYSA-N |
| SMILES | CC(COC1=CC(=C(C=C1)Br)F)(F)F |
Computed by PubChem (NCBI)