CAS 1536707-43-3 appears in our catalog under these names: 1-(4-Bromo-3-methylphenyl)-2,2,2-trifluoroethanol, 96%, 1-(4-Bromo-3-methylphenyl)-2,2,2-trifluoroethan-1-ol, 95%, 1-(4-Bromo-3-methylphenyl)-2,2,2-trifluoroethan-1-ol, 1-(4-Bromo-3-methylphenyl)-2,2,2-trifluoroethanol, 96%, 96%. Offered by: Fluorochem, Combi-blocks, Biosynth, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 0,5g.
1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanol (CAS 1536707-43-3) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanol. InChIKey: RIVPFERROZLXLY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanol |
| InChIKey | RIVPFERROZLXLY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)