CAS 1094438-85-3 is the registry number for 1-(Bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene (CAS 1094438-85-3) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-(bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene. InChIKey: NCRZHMNFZDUFGB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | NCRZHMNFZDUFGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)CBr |
Computed by PubChem (NCBI)