cas: 5860-95-7 — see every product listed under this CAS number, including other names
1-(2-Chlorophenyl)-2,2,2-trifluoroethanone, 96%, 96% (CAS 5860-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBQ4-100mg |
| cas | 5860-95-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 880.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-(2-chlorophenyl)-2,2,2-trifluoroethanone (CAS 5860-95-7) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 1-(2-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: RAOQEOLDFDHACL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | RAOQEOLDFDHACL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)