cas: 5860-95-7 — see every product listed under this CAS number, including other names
2'-Chloro-2,2,2-trifluoroacetophenone, 96% (CAS 5860-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F207014-100MG |
| cas | 5860-95-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1164.19 Pln | |
| Fluorochem | 10g | 2267.97 Pln | |
| Fluorochem | 25g | 5589.72 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(2-chlorophenyl)-2,2,2-trifluoroethanone (CAS 5860-95-7) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 1-(2-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: RAOQEOLDFDHACL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | RAOQEOLDFDHACL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)