cas: 56159-70-7 — see every product listed under this CAS number, including other names
1-(2-Chlorophenyl)-2-(3,4-dimethoxyphenyl)-1,2-ethanedione, 99%(GC-MS),RG, 99%(GC-MS),RG (CAS 56159-70-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GV9-1g |
| cas | 56159-70-7 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 25g | 683.60 Pln |
| purity | 99%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethane-1,2-dione (CAS 56159-70-7) is a chemical compound with the molecular formula C16H13ClO4 and a molecular weight of 304.72 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethane-1,2-dione. InChIKey: ULVSCSFZMZRZHJ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO4 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethane-1,2-dione |
| InChIKey | ULVSCSFZMZRZHJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C(=O)C2=CC=CC=C2Cl)OC |
Computed by PubChem (NCBI)