CAS 431985-11-4 appears in our catalog under these names: 2-Ethoxy-4-formylphenyl 4-chlorobenzoate, 95%, 2-Ethoxy-4-formylphenyl 4-chlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2-ethoxy-4-formylphenyl) 4-chlorobenzoate (CAS 431985-11-4) is a chemical compound with the molecular formula C16H13ClO4 and a molecular weight of 304.72 g/mol. IUPAC name: (2-ethoxy-4-formylphenyl) 4-chlorobenzoate. InChIKey: YIZWPZKKYYJJMS-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO4 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | (2-ethoxy-4-formylphenyl) 4-chlorobenzoate |
| InChIKey | YIZWPZKKYYJJMS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)