CAS 56159-70-7 appears in our catalog under these names: 2-Chloro-3',4'-dimethoxybenzil, 95%, 2-CHLORO-3',4'-DIMETHOXYBENZIL, 97%, 1-(2-Chlorophenyl)-2-(3,4-dimethoxyphenyl)-1,2-ethanedione, 99%(GC-MS),RG, 99%(GC-MS),RG. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 1g, 5g.
1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethane-1,2-dione (CAS 56159-70-7) is a chemical compound with the molecular formula C16H13ClO4 and a molecular weight of 304.72 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethane-1,2-dione. InChIKey: ULVSCSFZMZRZHJ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO4 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethane-1,2-dione |
| InChIKey | ULVSCSFZMZRZHJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C(=O)C2=CC=CC=C2Cl)OC |
Computed by PubChem (NCBI)