CAS 259149-65-0 is the registry number for 1,3-Benzodioxol-5-yl(4-(2-chloroethoxy)phenyl)methanone. Offered by: Biosynth. Available pack sizes: 100mg.
1,3-benzodioxol-5-yl-[4-(2-chloroethoxy)phenyl]methanone (CAS 259149-65-0) is a chemical compound with the molecular formula C16H13ClO4 and a molecular weight of 304.72 g/mol. IUPAC name: 1,3-benzodioxol-5-yl-[4-(2-chloroethoxy)phenyl]methanone. InChIKey: ADWQOWZXSUGBIC-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO4 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl-[4-(2-chloroethoxy)phenyl]methanone |
| InChIKey | ADWQOWZXSUGBIC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)C3=CC=C(C=C3)OCCCl |
Computed by PubChem (NCBI)