Products 161773-51-9
CAS 161773-51-9 appears in our catalog under these names: 7–methoxy Apigeninidin (chloride), Methoxyapigeninidin chloride, 7-Methoxy apigeninidin (chloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 5 mg, 1 mg, 10 mg.
2-(4-hydroxyphenyl)-7-methoxychromenylium-5-ol chloride (CAS 161773-51-9) is a chemical compound with the molecular formula C16H13ClO4 and a molecular weight of 304.72 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-7-methoxychromenylium-5-ol chloride. InChIKey: VQSWXDUWNOYURP-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO4 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-7-methoxychromenylium-5-ol chloride |
| InChIKey | VQSWXDUWNOYURP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C=CC(=[O+]C2=C1)C3=CC=C(C=C3)O)O.[Cl-] |
Computed by PubChem (NCBI)