Products 861518-79-8
CAS 861518-79-8 is the registry number for Tranexamic Acid Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[4-(chloromethyl)benzoyl]oxymethyl]benzoic acid (CAS 861518-79-8) is a chemical compound with the molecular formula C16H13ClO4 and a molecular weight of 304.72 g/mol. IUPAC name: 4-[[4-(chloromethyl)benzoyl]oxymethyl]benzoic acid. InChIKey: BCJRWOGHIGVWAR-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO4 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | 4-[[4-(chloromethyl)benzoyl]oxymethyl]benzoic acid |
| InChIKey | BCJRWOGHIGVWAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)C2=CC=C(C=C2)CCl)C(=O)O |
Computed by PubChem (NCBI)