cas: 41202-32-8 — see every product listed under this CAS number, including other names
1-(2-Chlorophenyl)piperazine Hydrochloride, 99%, 99% (CAS 41202-32-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CU2-1g |
| cas | 41202-32-8 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 218.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-(2-chlorophenyl)piperazine;hydrochloride (CAS 41202-32-8) is a chemical compound with the molecular formula C10H14Cl2N2 and a molecular weight of 233.13 g/mol. IUPAC name: 1-(2-chlorophenyl)piperazine;hydrochloride. InChIKey: GUTWDZXWTKMXPI-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | 1-(2-chlorophenyl)piperazine;hydrochloride |
| InChIKey | GUTWDZXWTKMXPI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)