CAS 951919-14-5 is the registry number for 1-(2,3-Dichlorophenyl)-N1,N1-dimethylethane-1,2-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,3-dichlorophenyl)-N,N-dimethylethane-1,2-diamine (CAS 951919-14-5) is a chemical compound with the molecular formula C10H14Cl2N2 and a molecular weight of 233.13 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-N,N-dimethylethane-1,2-diamine. InChIKey: OIRCTAUSZLSIFJ-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-N,N-dimethylethane-1,2-diamine |
| InChIKey | OIRCTAUSZLSIFJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(CN)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)