CAS 1341681-83-1 appears in our catalog under these names: 2-tert-Butyl-4,6-dichloro-5-ethylpyrimidine, 95%, 2-tert-Butyl-4,6-dichloro-5-ethylpyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 100mg, 1g.
2-tert-butyl-4,6-dichloro-5-ethylpyrimidine (CAS 1341681-83-1) is a chemical compound with the molecular formula C10H14Cl2N2 and a molecular weight of 233.13 g/mol. IUPAC name: 2-tert-butyl-4,6-dichloro-5-ethylpyrimidine. InChIKey: KFLXEXXSYYRNGQ-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | 2-tert-butyl-4,6-dichloro-5-ethylpyrimidine |
| InChIKey | KFLXEXXSYYRNGQ-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(N=C1Cl)C(C)(C)C)Cl |
Computed by PubChem (NCBI)