CAS 927997-19-1 is the registry number for (2-Amino-2-(3,4-dichlorophenyl)ethyl)dimethylamine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3,4-dichlorophenyl)-N',N'-dimethylethane-1,2-diamine (CAS 927997-19-1) is a chemical compound with the molecular formula C10H14Cl2N2 and a molecular weight of 233.13 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-N',N'-dimethylethane-1,2-diamine. InChIKey: YOFLNTLVVZMXLU-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-N',N'-dimethylethane-1,2-diamine |
| InChIKey | YOFLNTLVVZMXLU-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC(=C(C=C1)Cl)Cl)N |
Computed by PubChem (NCBI)