cas: 214262-96-1 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)cyclopentanecarboxylic acid, 98% (CAS 214262-96-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A715774-25g |
| cas | 214262-96-1 |
| size | 25g |
| availability | Global Stock: 4.816g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 1306.90 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 25g | 1060.06 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-fluorophenyl)cyclopentane-1-carboxylic acid (CAS 214262-96-1) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: AXWFKNJZMNAYGJ-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | AXWFKNJZMNAYGJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)