Products 214262-96-1
CAS 214262-96-1 appears in our catalog under these names: 1-(2-Fluorophenyl)cyclopentane-1-carboxylic acid, 97%, 1-(2-Fluorophenyl)cyclopentanecarboxylic acid, 96%, 1-(2-Fluorophenyl)cyclopentanecarboxylic acid, 98%. Offered by: Combi-blocks, Chemat, AmBeed, Fluorochem, BLDpharm. Available pack sizes: 100g, 1g, 25g, 10g, 5g, 100mg, 250mg.
1-(2-fluorophenyl)cyclopentane-1-carboxylic acid (CAS 214262-96-1) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: AXWFKNJZMNAYGJ-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | AXWFKNJZMNAYGJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)