CAS 1261956-33-5 is the registry number for Ethyl 1-(4-fluorophenyl)cyclopropanecarboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate (CAS 1261956-33-5) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: ethyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate. InChIKey: XSEBLFOXTYFEQC-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | ethyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate |
| InChIKey | XSEBLFOXTYFEQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)