CAS 214262-99-4 appears in our catalog under these names: 1-(4-Fluorophenyl)cyclopentanecarboxylic acid, 98%, 1-(4-Fluorophenyl)cyclopentanecarboxylic acid 98%, 1-(4-Fluorophenyl)cyclopentanecarboxylic acid, 96%, 1-(4-Fluorophenyl)cyclopentanecarboxylic acid, 96%, 96%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 10g, 500g, 250mg.
1-(4-fluorophenyl)cyclopentane-1-carboxylic acid (CAS 214262-99-4) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(4-fluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: VVMRZYODYMBLRJ-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(4-fluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | VVMRZYODYMBLRJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)