CAS 915923-90-9 appears in our catalog under these names: 1-(2-Fluorophenyl)-2,2-dimethylcyclopropanecarboxylic acid, 95%, 1-(2-Fluorophenyl)-2,2-dimethylcyclopropanecarboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(2-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 915923-90-9) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(2-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: AISGDNPYRXZDBS-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | AISGDNPYRXZDBS-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C2=CC=CC=C2F)C(=O)O)C |
Computed by PubChem (NCBI)