cas: 886369-74-0 — see every product listed under this CAS number, including other names
1-(3,4-Dichlorophenyl)-2,2,2-trifluoroethan-1-amine, 95% (CAS 886369-74-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F678674-50MG |
| cas | 886369-74-0 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 804.94 Pln | |
| Fluorochem | 100mg | 1054.85 Pln | |
| Fluorochem | 250mg | 1700.46 Pln | |
| Fluorochem | 500mg | 2575.15 Pln | |
| Fluorochem | 1g | 3319.68 Pln | |
| Fluorochem | 2.5g | 6974.65 Pln | |
| Fluorochem | 5g | 11952.06 Pln | |
| Chemat | 50mg | 635.60 Pln | |
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1341.20 Pln | |
| Chemat | 500mg | 1595.60 Pln | |
| Chemat | 1g | 2618.00 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-(3,4-dichlorophenyl)-2,2,2-trifluoroethanamine (CAS 886369-74-0) is a chemical compound with the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: LVAQDAHAPUCCNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F3N |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | LVAQDAHAPUCCNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(F)(F)F)N)Cl)Cl |
Computed by PubChem (NCBI)