CAS 886369-74-0 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-2,2,2-trifluoroethanamine, 98%, 1-(3,4-Dichlorophenyl)-2,2,2-trifluoroethan-1-amine, 95%, 95%, 1-(3,4-Dichlorophenyl)-2,2,2-trifluoroethan-1-amine, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 50mg, 500mg, 2.5g.
1-(3,4-dichlorophenyl)-2,2,2-trifluoroethanamine (CAS 886369-74-0) is a chemical compound with the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: LVAQDAHAPUCCNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F3N |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | LVAQDAHAPUCCNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(F)(F)F)N)Cl)Cl |
Computed by PubChem (NCBI)