CAS 1039986-74-7 is the registry number for (3,5-Dichloro-phenyl)-(2,2,2-trifluoro-ethyl)-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3,5-dichloro-N-(2,2,2-trifluoroethyl)aniline (CAS 1039986-74-7) is a chemical compound with the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. IUPAC name: 3,5-dichloro-N-(2,2,2-trifluoroethyl)aniline. InChIKey: STMGXIZOQUSLLR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F3N |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 3,5-dichloro-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | STMGXIZOQUSLLR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)NCC(F)(F)F |
Computed by PubChem (NCBI)