CAS 1212992-00-1 is the registry number for (R)-1-(3,5-Dichlorophenyl)-2,2,2-trifluoroethanamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanamine (CAS 1212992-00-1) is a chemical compound with the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. IUPAC name: (1R)-1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: LMPAYUBQCZTOPN-SSDOTTSWSA-N.
| Molecular formula | C8H6Cl2F3N |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | (1R)-1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | LMPAYUBQCZTOPN-SSDOTTSWSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)