CAS 886371-14-8 is the registry number for 1-(2,3-Dichlorophenyl)-2,2,2-trifluoroethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,3-dichlorophenyl)-2,2,2-trifluoroethanamine (CAS 886371-14-8) is a chemical compound with the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: OULNGNJINGDFDA-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F3N |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | OULNGNJINGDFDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(C(F)(F)F)N |
Computed by PubChem (NCBI)