CAS 1356110-02-5 appears in our catalog under these names: 2,3-Bis(chloromethyl)-6-(trifluoromethyl)pyridine, 95+%, 2,3-Bis(chloromethyl)-6-(trifluoromethyl)pyridine, 95%, 95%, 2,3-Bis(chloromethyl)-6-(trifluoromethyl)pyridine, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 100mg.
2,3-bis(chloromethyl)-6-(trifluoromethyl)pyridine (CAS 1356110-02-5) is a chemical compound with the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. IUPAC name: 2,3-bis(chloromethyl)-6-(trifluoromethyl)pyridine. InChIKey: LDAJXLATKMNLOI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F3N |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2,3-bis(chloromethyl)-6-(trifluoromethyl)pyridine |
| InChIKey | LDAJXLATKMNLOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1CCl)CCl)C(F)(F)F |
Computed by PubChem (NCBI)