cas: 186347-67-1 — see every product listed under this CAS number, including other names
1-(3,4-Difluorophenyl)cyclopropanecarboxylic acid, 97%, 97% (CAS 186347-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BAVN-100mg |
| cas | 186347-67-1 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 438.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 186347-67-1) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 1-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: BYUXTEWDOBYESO-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | BYUXTEWDOBYESO-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)