CAS 62679-61-2 appears in our catalog under these names: 4,4-Difluoro-1-phenylbutane-1,3-dione, 95%, 4,4-DIFLUORO-1-PHENYL-1,3-BUTANEDIONE, &, 4,4-Difluoro-1-phenyl-1,3-butanedione, 95%, 95%, 4,4-Difluoro-1-phenyl-1,3-butanedione, 97%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g.
4,4-difluoro-1-phenylbutane-1,3-dione (CAS 62679-61-2) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 4,4-difluoro-1-phenylbutane-1,3-dione. InChIKey: JTIPWONXTZMDOK-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 4,4-difluoro-1-phenylbutane-1,3-dione |
| InChIKey | JTIPWONXTZMDOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(F)F |
Computed by PubChem (NCBI)