Products 1157561-73-3

CAS 1157561-73-3 is the registry number for 2-(3,4-Difluorophenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 1157561-73-3) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: CSLVZAGSOJLXCT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F2O2
Molecular weight198.17 g/mol
IUPAC name2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid
InChIKeyCSLVZAGSOJLXCT-UHFFFAOYSA-N
SMILESC1C(C1C(=O)O)C2=CC(=C(C=C2)F)F

Computed by PubChem (NCBI)